S8911814
Aflatoxin B1 from Aspergillus flavus , fromAspergillusflavus , 1162-65-8
Synonym(s):
Mycotoxins
CAS NO.:1162-65-8
Empirical Formula: C17H12O6
Molecular Weight: 312.27
MDL number: MFCD00869647
EINECS: 214-603-3
| Pack Size | Price | Stock | Quantity |
| 1mg | RMB634.40 | In Stock |
|
| 5mg | RMB1843.69 | In Stock |
|
| 10mg | RMB3160.87 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 268-269 °C |
| alpha | D -558° (c = 0.1 in CHCl3); D -480° (c = 0.1 in DMF) |
| Boiling point: | 372.21°C (rough estimate) |
| Density | 1.2810 (rough estimate) |
| refractive index | 1.4800 (estimate) |
| Flash point: | 2 °C |
| storage temp. | 2-8°C |
| solubility | DMF: 20 mg/ml; DMF:PBS(pH 7.2)(1:1): 0.5 mg/ml; DMSO: 12 mg/ml |
| form | White to yellow powder. |
| color | White to yellow |
| biological source | Aspergillus flavus |
| Water Solubility | 15mg/L(temperature not stated) |
| Merck | 13,180 |
| BRN | 1269174 |
| Stability: | Stable. Incompatible with strong oxidizing agents. May be light or air sensitive. |
| Major Application | cleaning products cosmetics food and beverages personal care |
| InChI | 1S/C17H12O6/c1-20-10-6-11-14(8-4-5-21-17(8)22-11)15-13(10)7-2-3-9(18)12(7)16(19)23-15/h4-6,8,17H,2-3H2,1H3/t8-,17+/m0/s1 |
| InChIKey | OQIQSTLJSLGHID-WNWIJWBNSA-N |
| SMILES | [H][C@]12OC=C[C@@]1([H])c3c(O2)cc(OC)c4C5=C(C(=O)CC5)C(=O)Oc34 |
| LogP | 2.039 (est) |
| EPA Substance Registry System | Aflatoxin B1 (1162-65-8) |
Description and Uses
Aflatoxin B1 is the major analogue of a family of bisfuranocoumarin mycotoxins produced by Aspergillus flavus and related species. Aflatoxin B1 exhibits a distinctive UV spectrum and blue fluorescence. Aflatoxins are among the most potent mycotoxins known but are in fact "pre-toxins", requiring metabolic activation to the toxic principle. Aflatoxins are found widely in nature in trace amounts, particularly in grains and nuts. The toxicity of these metabolites was first recognised in the 1950s and their structures elucidated in 1963. Aflatoxins have been extensively reviewed.
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H300+H310+H330-H340-H350-H361 |
| Precautionary statements | P201-P262-P280-P301+P310+P330-P302+P352+P310-P304+P340+P310 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | T+,T,Xn,F |
| Risk Statements | 45-46-26/27/28-36-20/21/22-11-65-48/23/24/25-36/38-39/23/24/25-23/24/25 |
| Safety Statements | 53-45-36-26-16-24-7-62-36/37-28 |
| RIDADR | UN 3462 6.1/PG 1 |
| WGK Germany | 3 |
| RTECS | GY1925000 |
| F | 10 |
| HazardClass | 6.1(a) |
| PackingGroup | I |
| HS Code | 29322090 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Flam. Liq. 2 |
| Hazardous Substances Data | 1162-65-8(Hazardous Substances Data) |
| Toxicity | LD50 orally in day old duckling: 18.2 mg/50 gm body wt (Carnaghan); i.p. in newborn mice: 9.50 mg/kg body wt (Büchi) |








