S441678
7-Hydroxy-3,4,8-trimethylcoumarin , 97% , 91963-11-0
| Pack Size | Price | Stock | Quantity |
| 5g | RMB1149.81 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 278-280 °C (lit.) |
| storage temp. | 2-8°C, stored under nitrogen |
| Appearance | White to off-white Solid |
| InChI | 1S/C12H12O3/c1-6-7(2)12(14)15-11-8(3)10(13)5-4-9(6)11/h4-5,13H,1-3H3 |
| InChIKey | GNBLUSRSAGXTJN-UHFFFAOYSA-N |
| SMILES | CC1=C(C)c2ccc(O)c(C)c2OC1=O |
Description and Uses
7-Hydroxy-3,4,8-trimethylcoumarin (cas# 91963-11-0) is a compound useful in organic synthesis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
