PRODUCT Properties
| Boiling point: | 110-115 °C/0.004 mmHg (lit.) |
| Density | 1.138 g/mL at 25 °C (lit.) |
| refractive index | n20/D 1.556(lit.) |
| Flash point: | 113 °C |
| pka | -2.37±0.20(Predicted) |
| optical activity | [α]24/D +61°, c = 2 in ethanol |
| InChI | 1S/C12H11NO2/c1-9(10-5-3-2-4-6-10)13-11(14)7-8-12(13)15/h2-9H,1H3/t9-/m1/s1 |
| InChIKey | PWZXUQWQRVKGAH-SECBINFHSA-N |
| SMILES | C[C@@H](N1C(=O)C=CC1=O)c2ccccc2 |
Description and Uses
This optically active maleimide undergoes radical copolymerization with styrene to yield a ~1:1 copolymer (~98%). Vinyl copolymers with asymmetric main chains can be used as nonlinear optical materials. Dienophile for diastereoselective Diels-Alder reactions.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
