S8923614
CYP450substrate , 87687-02-3
Synonym(s):
7-Benzyloxy-3H-phenoxazin-3-one;7-Benzyloxyresorufin;O7-Benzylresorufin
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB3358.36 | In Stock |
|
| 10mg | RMB6183.36 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 148 - 151°C |
| Boiling point: | 479.9±45.0 °C(Predicted) |
| Density | 1.26±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), DMSO (Very Slightly), Methanol (Very Slightly) |
| pka | 1.36±0.20(Predicted) |
| form | Solid |
| color | Red to Very Dark Brown |
| Appearance | Solid Powder |
| InChI | 1S/C19H13NO3/c21-14-6-8-16-18(10-14)23-19-11-15(7-9-17(19)20-16)22-12-13-4-2-1-3-5-13/h1-11H,12H2 |
| InChIKey | XNZRYTITWLGTJS-UHFFFAOYSA-N |
| SMILES | O=C1C=CC2=Nc3ccc(OCc4ccccc4)cc3OC2=C1 |
Description and Uses
Resorufin benzyl ether is a red fluorometric probe that acts as a substrate for cytochrome P450 CYP3A4. It is used to screen the inhibition/activation potential of test compounds, to predict potential drug-drug interactions, or to monitor other CYP450 activities.
Fluorimetric substrate for cytochrome P450-linked enzymes.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




