S8931314
proteasesubstrate , 54799-93-8
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB1836.02 | In Stock |
|
| 10mg | RMB3176.09 | In Stock |
|
| 50mg | RMB10941.10 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| storage temp. | -20°C |
| solubility | methanol: 10 mg/mL, clear, light yellow |
| form | powder |
| BRN | 3027332 |
| InChIKey | PYVSMZDQQUZGPF-JAQKLANPSA-N |
| SMILES | Cl.CC(C)[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)c2ccccc2)C(=O)N[C@@H](CCCNC(N)=N)C(=O)Nc3ccc(cc3)[N+]([O-])=O |
Description and Uses
- -Benzoyl-Phe-Val-Arg-p-nitroanilide hydrochloride has been used: as a substrate: for trypsin-like enzyme in the soluble and particulate fractions of the hyphae
- for the thrombin, recombinant and native batroxobin from snake venom
- for fibrinolytic enzyme aprE2 in amidolytic activity assay
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280-P304+P340-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38-40 |
| Safety Statements | 26-36-24/25-22 |
| WGK Germany | 3 |
| HS Code | 2925290090 |
| Storage Class | 11 - Combustible Solids |






