S893378
Titanium(IV) tert-butoxide , depositiongrade , 3087-39-6
Synonym(s):
Tetra-tert-butyl orthotitanate
CAS NO.：3087-39-6
Empirical Formula: C16H36O4Ti
Molecular Weight: 340.32
MDL number: MFCD00040554
EINECS: 221-412-9
| Pack Size | Price | Stock | Quantity |
| 25ml | RMB1435.56 | In Stock |
|
| 50ml | RMB2666.04 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 70 °C (2 mmHg) |
| Density | 0.881 g/mL at 25 °C(lit.) |
| vapor pressure | 43 hPa ( 136 °C) |
| refractive index | n |
| Flash point: | 47°C |
| storage temp. | Store below +30°C. |
| form | Liquid |
| Specific Gravity | 0.89 |
| color | Clear colorless |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| Sensitive | moisture sensitive |
| BRN | 3681801 |
| Cosmetics Ingredients Functions | NOT REPORTED |
| InChI | InChI=1S/4C4H9O.Ti/c4*1-4(2,3)5;/h4*1-3H3;/q4*-1;+4 |
| InChIKey | GRWPYGBKJYICOO-UHFFFAOYSA-N |
| SMILES | [Ti](OC(C)(C)C)(OC(C)(C)C)(OC(C)(C)C)OC(C)(C)C |
| LogP | 2.84 at 25℃ |
| EPA Substance Registry System | 2-Propanol, 2-methyl-, titanium(4+) salt (4:1) (3087-39-6) |
Description and Uses
tert-Butoxytitanium (IV) is used in the preparation of moisture-curable modified polysiloxane and silicone rubber.
Safety
| Symbol(GHS) |   GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H319 |
| Precautionary statements | P210-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 10-36/37/38 |
| Safety Statements | 16-26-36 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| F | 10-21 |
| TSCA | TSCA listed |
| HS Code | 29319090 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 |
