S894979
methylacetatesolution , 39746-25-3
Synonym(s):
16,16-Dimethyl-PGE2
| Pack Size | Price | Stock | Quantity |
| 1mg | RMB2307.42 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 541.271±50.00 °C(Press: 760.00 Torr)(predicted) |
| Density | 1.119±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) |
| Flash point: | -13℃ |
| storage temp. | -20°C |
| solubility | Soluble in methyl acetate |
| pka | 4.754±0.10(predicted) |
| form | methyl acetate solution |
| color | Colorless to light yellow |
| biological source | synthetic (organic) |
| InChIKey | QAOBBBBDJSWHMU-WMBBNPMCSA-N |
| SMILES | CCCCC(C)(C)[C@H](O)\C=C\[C@H]1[C@H](O)CC(=O)[C@@H]1C\C=C/CCCC(O)=O |
Description and Uses
16,16-dimethyl PGE2 is a competitive inhibitor of 15-
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H225-H319-H336 |
| Precautionary statements | P210-P305+P351+P338 |
| target organs | Central nervous system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | F,Xn,Xi |
| Risk Statements | 11-20/21/22-36/37/38-67-66-36 |
| Safety Statements | 16-26-36 |
| RIDADR | UN 1231 3/PG 2 |
| WGK Germany | 3 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 2 STOT SE 3 |







