S8959614
≥98%(HPLC),powder , 10141-51-2
Synonym(s):
p-Isopentoxyaniline
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB1892.06 | In Stock |
|
| 25mg | RMB7241.72 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 154-159 °C |
| storage temp. | room temp |
| solubility | DMSO: 22 mg/mL |
| form | solid |
| color | off-white |
| InChI | 1S/C11H17NO.ClH/c1-9(2)7-8-13-11-5-3-10(12)4-6-11;/h3-6,9H,7-8,12H2,1-2H3;1H |
| InChIKey | GFESZSNFRSACMU-UHFFFAOYSA-N |
| SMILES | Cl[H].CC(C)CCOc1ccc(N)cc1 |
Description and Uses
CP-24879 (hydrochloride) is a potent, selective and combined delta5D/delta6D inhibitor. CP-24879 (hydrochloride) can significantly reduce intracellular lipid accumulation and inflammatory injury in hepatocytes. CP-24879 (hydrochloride) exhibits superior antisteatotic and anti-inflammatory actions in fat-1 and ω-3-treated hepatocytes, and can be used for non-alcoholic steatohepatitis research[1][2].
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
