S8967914
≥98%(HPLC),powder , 162870-29-3
Synonym(s):
S-DHPG
CAS NO.:162870-29-3
Empirical Formula: C8H9NO4
Molecular Weight: 183.16
MDL number: MFCD00673763
EINECS: 2017-001-1
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB2226.94 | In Stock |
|
| 10mg | RMB4440.85 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >207°C (dec.) |
| Boiling point: | 448.8±33.0 °C(Predicted) |
| Density | 1.550±0.06 g/cm3(Predicted) |
| storage temp. | −20°C |
| solubility | Aqueous Base (Very Slightly, Sonicated), Methanol (Slightly), Water (Slightly, Heated) |
| pka | 1.77±0.10(Predicted) |
| form | solid |
| color | white |
| Water Solubility | Soluble to 50 mM in water |
| Stability: | Hygroscopic |
| InChI | 1S/C8H9NO4.H2O/c9-7(8(12)13)4-1-5(10)3-6(11)2-4;/h1-3,7,10-11H,9H2,(H,12,13);1H2/t7-;/m0./s1 |
| InChIKey | QZEFIWWBQUKNFA-FJXQXJEOSA-N |
| SMILES | O.N[C@H](C(O)=O)c1cc(O)cc(O)c1 |
Description and Uses
(S)-3,5-Dihydroxylphenylglycine is a potent agonist of group I metabotropic glutamate receptors mGluR1 and mGluR5. (S)-3,5-Dihydroxylphenylglycine have been utilized for the treatment of neuronal injury and cognitive enhancement.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






