PRODUCT Properties
| Density | 1.66±0.1 g/cm3(Predicted) |
| storage temp. | -20°C |
| solubility | H2O: 50 mg/mL, clear, colorless |
| pka | 1.16±0.50(Predicted) |
| form | powder |
| color | White to off-white |
| InChIKey | IRILGPHKFKSRQN-ASEPKIFHSA-N |
| SMILES | O.CCCCCCCCCC(=O)SCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)COP(O)(=O)OP(O)(=O)OC[C@H]1O[C@H]([C@H](O)[C@@H]1OP(O)(O)=O)n2cnc3c(N)ncnc23 |
Description and Uses
Decanoyl coenzyme A monohydrate has been used in the phosphatidylinositol 4,5-bisphosphate inhibition studies (LC-CoA) and in the human diacylglycerol acyltransferase 1 and 2 assays.
Safety
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| F | 10-21 |
| Storage Class | 11 - Combustible Solids |
