S8995914
solid , 63701-55-3
Synonym(s):
Arbaclofen hydrochloride;R(+)-β-(Aminomethyl)-4-chlorobenzenepropanoic acid hydrochloride;STX209
CAS NO.：63701-55-3
Empirical Formula: C10H13Cl2NO2
Molecular Weight: 250.12
MDL number: MFCD00078579
| Pack Size | Price | Stock | Quantity |
| 25mg | RMB1886.47 | In Stock |
|
| 100mg | RMB5885.94 | In Stock |
|
| 500mg | RMB21868.45 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 220～222℃ |
| storage temp. | Store at -20°C |
| solubility | DMSO: >20 mg/mL |
| form | solid |
| color | white |
| optical activity | [α]28/D +3.8°, c = 0.9 in methanol(lit.) |
| InChI | 1S/C10H12ClNO2.ClH/c11-9-3-1-7(2-4-9)8(6-12)5-10(13)14;/h1-4,8H,5-6,12H2,(H,13,14);1H/t8-;/m0./s1 |
| InChIKey | WMNUVYYLMCMHLU-QRPNPIFTSA-N |
| SMILES | Cl[H].NC[C@H](CC(O)=O)c1ccc(Cl)cc1 |
Description and Uses
R(+)-Baclofen.Hydrochloride is a derivative of gamma-aminobutyric acid primarily used to treat spasticity.
Safety
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 24/25 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | MW5084350 |
| Storage Class | 11 - Combustible Solids |
