S8996014
≥98%(HPLC),solid , 63701-56-4
CAS NO.：63701-56-4
Empirical Formula: C10H13Cl2NO2
Molecular Weight: 250.122
MDL number: MFCD00078580
| Pack Size | Price | Stock | Quantity |
| 25mg | RMB1886.47 | In Stock |
|
| 100mg | RMB5870.58 | In Stock |
|
| 500mg | RMB22691.69 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 194-195 °C(Solv: methanol (67-56-1)) |
| solubility | DMSO: >20 mg/mL |
| form | solid |
| color | white |
| optical activity | [α]28/D 2.2°, c = 0.9 in methanol(lit.) |
| InChI | 1S/C10H12ClNO2.ClH/c11-9-3-1-7(2-4-9)8(6-12)5-10(13)14;/h1-4,8H,5-6,12H2,(H,13,14);1H/t8-;/m1./s1 |
| InChIKey | WMNUVYYLMCMHLU-DDWIOCJRSA-N |
| SMILES | Cl[H].NC[C@@H](CC(O)=O)c1ccc(Cl)cc1 |
Description and Uses
S(-)-Baclofen Hydrochloride is a GABAB receptor agonist. Also, it is an effective antagonist of muscimol.
Safety
| PPE | Eyeshields, Gloves, type N95 (US) |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | MW5084400 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
