S9003914
proteasesubstrate , 79642-99-2
| Pack Size | Price | Stock | Quantity |
| 1mg | RMB651.78 | In Stock |
|
| 10mg | RMB2995.86 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 996.422±65.00 °C(Press: 760.00 Torr)(predicted) |
| Density | 1.273±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) |
| storage temp. | -20°C |
| solubility | DMF: 50mg/mL, clear, colorless to faintly yellow |
| form | powder |
| pka | 4.640±0.10(predicted) |
| InChIKey | QFJWKXYGBSQMDX-UHFFFAOYSA-N |
| SMILES | COc1cc(NC(=O)C(Cc2ccccc2)NC(=O)C(C)NC(=O)C(C)NC(=O)CCCC(O)=O)cc3ccccc13 |
Description and Uses
A novel alkylamides of carboxyalkanoyl peptides which are capable of inhibiting elastase.





