S9020114
≥85%(HPLC) , 11079-53-1
CAS NO.：11079-53-1
Empirical Formula: C35H52O4
Molecular Weight: 536.78
MDL number: MFCD01861497
EINECS: 601-000-9
| Pack Size | Price | Stock | Quantity |
| 250μG | RMB2514.38 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 79-80℃ |
| alpha | D18 +41° (in ethanol) |
| Boiling point: | 616.8±55.0 °C(Predicted) |
| Density | 1.010±0.06 g/cm3 (20 ºC 760 Torr) |
| Flash point: | 9℃ |
| storage temp. | -20°C |
| pka | 4.8 (50% aq ethanol) |
| form | solution |
| InChIKey | IWBJJCOKGLUQIZ-HQKKAZOISA-N |
| SMILES | CC(C)C(=O)[C@@]12C(O)=C(C\C=C(\C)C)C(=O)[C@@](C\C=C(/C)C)(C[C@H](C\C=C(\C)C)[C@@]1(C)CC\C=C(\C)C)C2=O |
| CAS DataBase Reference | 11079-53-1 |
Description and Uses
Hyperforin may be used:
- as a reference standard for calibration curve generation in high-perfornamce liquid chromatography (HPLC) analysis
- to test its cytotoxic effect and apoptosis induction in mouse embryonic cells
- as a pregnane X receptor (PXR) in porcine brain capillary endothelial cells for transport assay
Safety
| Symbol(GHS) |    GHS02,GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H225-H301+H311+H331-H370 |
| Precautionary statements | P210-P280-P301+P310+P330-P302+P352+P312-P304+P340+P311 |
| target organs | Eyes |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | F,T |
| Risk Statements | 11-23/24/25-39/23/24/25 |
| Safety Statements | 7-16-36/37-45 |
| RIDADR | UN1230 - class 3 - PG 2 - Methanol |
| WGK Germany | 3 |
| HS Code | 29144000 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Flam. Liq. 2 STOT SE 1 |
| Hazardous Substances Data | 11079-53-1(Hazardous Substances Data) |
