PRODUCT Properties
| storage temp. | -20°C |
| solubility | H2O: insoluble |
| form | powder |
| Water Solubility | H2O: insoluble |
| InChI | 1S/C16H20N2O/c1-11(2)9-15(17)16(19)18-14-8-7-12-5-3-4-6-13(12)10-14/h3-8,10-11,15H,9,17H2,1-2H3,(H,18,19)/t15-/m0/s1 |
| InChIKey | JWHURRLUBVMKOT-HNNXBMFYSA-N |
| SMILES | CC(C)C[C@H](N)C(=O)Nc1ccc2ccccc2c1 |
Description and Uses
L-Leucine-β-naphthylamide is used in the synthesis of protein tyrosine phosphatase inhibitors. Used as an agent to combat Leishmania major.
Safety
| Symbol(GHS) |  GHS08 |
| Signal word | Warning |
| Hazard statements | H351 |
| Precautionary statements | P281 |
| PPE | Eyeshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | Xn |
| Risk Statements | 40 |
| Safety Statements | 22-36 |
| WGK Germany | 3 |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Carc. 2 |
