S9042814
elastaseinhibitor , 65144-34-5
Synonym(s):
N-(Methoxysuccinyl)-L -alanyl-L -alanyl-L -prolyl-L -valine chloromethylketone
CAS NO.:65144-34-5
Empirical Formula: C22H35ClN4O7
Molecular Weight: 502.99
MDL number: MFCD00077136
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB1191.46 | In Stock |
|
| 10mg | RMB2065.64 | In Stock |
|
| 25mg | RMB4118.62 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 159-161 °C |
| Boiling point: | 809.4±65.0 °C(Predicted) |
| Density | 1.234±0.06 g/cm3(Predicted) |
| storage temp. | -20°C |
| solubility | ethanol: 50 mg/mL, clear, colorless |
| pka | 13.05±0.20(Predicted) |
| form | Solid |
| color | white |
| Sensitive | Moisture Sensitive |
| BRN | 6167019 |
| Sequence | {MeOSuc}-Ala-Ala-Pro-Val-{CMK} |
| InChIKey | PJGDFLJMBAYGGC-XLPNERPQSA-N |
| SMILES | COC(=O)CCC(=O)N[C@@H](C)C(=O)N[C@@H](C)C(=O)N1CCC[C@H]1C(=O)N[C@@H](C(C)C)C(=O)CCl |
Description and Uses
A potent irreversible inhibitor of human leukocyte elastase





