S9052714
7-Methylguanosine 5′-triphosphate sodium salt , ≥85%(HPLC) , 104809-18-9
Synonym(s):
m7GTP
CAS NO.:104809-18-9
Empirical Formula: C11H18N4NaO14P3
Molecular Weight: 546.19
MDL number: MFCD00063376
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB1474.42 | In Stock |
|
| 10mg | RMB2533.72 | In Stock |
|
| 25mg | RMB5067.46 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| storage temp. | -20°C |
| solubility | water: 50 mg/mL, clear, colorless to faint yellow or tan |
| form | powder |
| biological source | natural (inorganic) |
| InChIKey | FSMRTZAMTMQMEF-OCMBMSOASA-M |
| SMILES | [Na+].C[n+]1cn([C@@H]2O[C@H](COP(O)(=O)OP(O)(=O)OP(O)([O-])=O)[C@@H](O)[C@H]2O)c3N=C(N)NC([O-])c13 |
Description and Uses
7-Methylguanosine 5′-triphosphate (m7GTP) is use to study the structures and mechanisms of eukaryotic cellular mRNA caps in the context of mRNA involvement in protein synthesis. m7GTP may be used to create affinity media for capture and purification of molecules such as eukaryotic initiation factor eIF4E.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P330-P501 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |






