S9068314
≥99%(HPLC),Bulkpackage , 4264-93-1
Synonym(s):
NASTRp disodium salt
CAS NO.:4264-93-1
Empirical Formula: C18H13ClNO5P.2Na
Molecular Weight: 435.71
MDL number: MFCD00717620
EINECS: 220-046-7
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB524.32 | In Stock |
|
| 1g | RMB1401.20 | In Stock |
|
| 5g | RMB4830.98 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| storage temp. | -20°C |
| solubility | H2O: 1 tablet/10 mL, clear, colorless |
| form | tablets |
| color | Off-white to light yellow |
| Water Solubility | water: 50mg/mL, clear, colorless to faintly yellow |
| InChI | InChI=1S/C18H15ClNO5P.2Na/c1-11-8-14(19)6-7-16(11)20-18(21)15-9-12-4-2-3-5-13(12)10-17(15)25-26(22,23)24;;/h2-10H,1H3,(H,20,21)(H2,22,23,24);;/q;2*+1/p-2 |
| InChIKey | TYCHZTPSWMGRRI-UHFFFAOYSA-L |
| SMILES | C1(C(=O)NC2C=CC(Cl)=CC=2C)C=C2C(C=CC=C2)=CC=1OP([O-])([O-])=O.[Na+].[Na+] |
Description and Uses
Naphthol AS-TR Phosphate Disodium Salt is a sodium salt analog of Naphthol AS-TR Phosphate(N367985), which is a novel composition useful for treating cancer.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280-P304+P340-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| F | 8-10-21 |
| HS Code | 2924297099 |
| Storage Class | 11 - Combustible Solids |






![Naphthol AS-TR Phosphate [for Biochemical Research]](https://img.chemicalbook.com/CAS/GIF/2616-72-0.gif)
