M4546753
3-Hydroxy-2-naphthanilidephosphate , >99%(TLC) , 13989-98-5
Synonym(s):
3-Hydroxy-2-naphthanilide phosphate
CAS NO.:13989-98-5
Empirical Formula: C17H14NO5P
Molecular Weight: 343.27
MDL number: MFCD00036182
EINECS: 237-789-8
| Pack Size | Price | Stock | Quantity |
| 500mg | RMB1391.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| storage temp. | -20°C |
| solubility | ethanol: 50mg/mL, clear, light yellow |
| form | powder |
| BRN | 2772810 |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | 1S/C17H14NO5P/c19-17(18-14-8-2-1-3-9-14)15-10-12-6-4-5-7-13(12)11-16(15)23-24(20,21)22/h1-11H,(H,18,19)(H2,20,21,22) |
| InChIKey | KVIYXIWBXOQZDN-UHFFFAOYSA-N |
| SMILES | OP(O)(=O)Oc1cc2ccccc2cc1C(=O)Nc3ccccc3 |
| CAS DataBase Reference | 13989-98-5(CAS DataBase Reference) |
Description and Uses
Naphthol AS phosphate is a histochemical substrate for acid and alkaline phosphatase.Dyes and metabolites.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 10-21 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






