PRODUCT Properties
| Melting point: | 211-212°C (dec.) |
| storage temp. | 2-8°C |
| solubility | DMF: 25 mg/mL, clear, light yellow |
| form | Solid |
| color | Off-White |
| BRN | 1445509 |
| InChIKey | HWBFEVWOQMUQIE-MVEDJEFUSA-N |
| SMILES | CC(=O)N[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@H]1O[C@H]2[C@H](O)[C@@H](NC(C)=O)[C@@H](O[C@@H]2CO)Oc3ccc(cc3)[N+]([O-])=O |
Description and Uses
4-Nitrophenyl N,N′-diacetyl-β-D-chitobioside has been used to measure the exochitinase activity of DOI, a novel protein from Chinese yam (Dioscorea opposita Thunb.) and exochitinase activity of ChiEn3 from Coprinopsis cinerea. It has also been used to determine the activity of a chitinolytic enzyme, N-acetyl-β-D-glucosaminidases.
Safety
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| F | 3-10 |
| HS Code | 29329990 |
| Storage Class | 11 - Combustible Solids |
