synthetic , 14152-28-4
Synonym(s):
(13E,15S)-15-Hydroxy-9-oxoprosta-10,13-dien-1-oic acid;7-[(1R,2S)-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopent-3-en-1-yl]heptanoic acid;PGA1
CAS NO.:14152-28-4
Empirical Formula: C20H32O4
Molecular Weight: 336.47
MDL number: MFCD00077858
EINECS: 682-017-9
| Pack Size | Price | Stock | Quantity |
| 1mg | RMB1400.90 | In Stock |
|
| 5mg | RMB4872.47 | In Stock |
|
| 10mg | RMB8283.57 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 43°C |
| Boiling point: | 392.93°C (rough estimate) |
| Density | 1.0192 (rough estimate) |
| refractive index | 1.4434 (estimate) |
| storage temp. | -20°C |
| solubility | acetone: 10 mg/mL, clear |
| pka | 4.77±0.10(Predicted) |
| form | White solid. |
| color | Off-white |
| biological source | synthetic |
| BRN | 2003401 |
| Stability: | Stable for 1 year from date of purchase as supplied. Solutions in DMSO or ethanol may be stored at -20°C for up to 1 month. |
| InChI | 1S/C20H32O4/c1-2-3-6-9-17(21)14-12-16-13-15-19(22)18(16)10-7-4-5-8-11-20(23)24/h12-18,21H,2-11H2,1H3,(H,23,24)/b14-12+/t16-,17-,18+/m0/s1 |
| InChIKey | BGKHCLZFGPIKKU-LDDQNKHRSA-N |
| SMILES | O=C1[C@H](CCCCCCC(O)=O)[C@@H](/C=C/[C@H](CCCCC)O)C=C1 |
Description and Uses
Prostaglandin A1 (PGA1) was first isolated as a dehydration product of the PGE1 compounds found in human semen. It has been shown to cause renal vasodilation, increased urine sodium excretion, and lowered arterial pressure in hypertensive patients. It also has growth-
Prostaglandin A1 has been shown to inhibit human immunodeficiency virus type 1 (HIV-1) replication in various cell types. In addition, as a precursor to the anti-inflammatory prostaglandins, it activates pro-inflammatory PGD2 receptor CRTH2 initiating the anti-inflammatory response.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H302-H360F |
| Precautionary statements | P201-P301+P312+P330-P308+P313 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| RTECS | GY5977900 |
| F | 8-10 |
| HS Code | 2937500000 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Oral Repr. 1B |






