1204834-00-3
CAS NO.:1204834-00-3
Empirical Formula: C23H40N4O12
Molecular Weight: 564.583
MDL number: MFCD13184949
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB1840.98 | In Stock |
|
| 1000mg | RMB4152.26 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| storage temp. | -20°C |
| solubility | Soluble in DMSO, DCM, DMF |
| form | solid or viscous liquid |
| color | Colorless to light yellow |
| InChIKey | AZXJVYAMFTUKFC-UHFFFAOYSA-N |
| SMILES | O=C(ON1C(CCC1=O)=O)CCOCCOCCOCCOCCOCCOCCOCCOCCN=[N+]=[N-] |
Description and Uses
Azido-PEG8-NHS ester is a popular click chemistry reagent with an azide and an NHS ester. The hydrophilic PEG spacer increases solubility in aqueous media. The azide group can react with alkyne, BCN, DBCO via Click Chemistry to yield a stable triazole linkage. The NHS ester can be used to label the primary amines (-NH2) of proteins, amine-modified oligonucleotides, and other amine-containing molecules.
Azido-PEG8-NHS ester series of products contain an azide function on one end of a single molecular weight dPEG spacer and a reactive group on the other end of the spacer. The dPEG spacer is hydrophilic and non-immunogenic and improves the water solubility of the target molecule while reducing the immunogenicity and increasing the hydrodynamic volume of the target.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280-P302+P352 |
| WGK Germany | WGK 3 |
| HS Code | 3822000000 |
| Storage Class | 11 - Combustible Solids |





