S9129514
≥98%(HPLC),powder , 181632-25-7
Synonym(s):
5-HT 2C receptor antagonist, SB 242084 Hydrochloride, SB-242084 Hydrochloride, SB242084 Hydrochloride;6-Chloro-2,3-dihydro-5-methyl-N-[6-[(2-methyl-3-pyridinyl)oxy]-3-pyridinyl]-1H-indole-1-carboxyamide dihydrochloride hydrate;6-Chloro-5-methyl-1-[[2-(2-methylpyrid-3-yloxy)pyrid-5-yl]carbamoyl]indoline dihydrochloride hydrate;SB 242084 Hydrochloride - CAS 181632-25-7 - Calbiochem
CAS NO.:181632-25-7
Empirical Formula: C21H19ClN4O2
Molecular Weight: 394.85
MDL number: MFCD02684417
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB9352.78 | In Stock |
|
| 25mg | RMB32233.93 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 181-183℃ |
| Boiling point: | 620.1±55.0 °C(Predicted) |
| Density | 1.362±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMSO: soluble15mg/mL, clear |
| pka | 12.47±0.20(Predicted) |
| form | powder |
| color | white to beige |
| InChI | InChI=1S/C21H19ClN4O2/c1-13-10-15-7-9-26(18(15)11-17(13)22)21(27)25-16-5-6-20(24-12-16)28-19-4-3-8-23-14(19)2/h3-6,8,10-12H,7,9H2,1-2H3,(H,25,27) |
| InChIKey | GCMNSEILNIPNSX-UHFFFAOYSA-N |
| SMILES | N1(C(NC2=CC=C(OC3=CC=CN=C3C)N=C2)=O)C2=C(C=C(C)C(Cl)=C2)CC1 |
Description and Uses
SB 242084 is a 5-HT2C receptor antagonist that displays 158- and 100-fold selectivity over 5-HT2A and 5-HT2B receptors respectively. SB 242084 displays selectivity over a range of other 5-HT, dopamine and adrenergic receptors.SB 242084 os a brain penetrant; exerts anxiolytic-like activity.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |






