BD1087732
N-Methylbenzamide , 97% , 613-93-4
CAS NO.:613-93-4
Empirical Formula: C8H9NO
Molecular Weight: 135.16
MDL number: MFCD00011642
EINECS: 210-362-3
| Pack Size | Price | Stock | Quantity |
| 1g | RMB26.40 | In Stock |
|
| 5g | RMB80.00 | In Stock |
|
| 10g | RMB155.20 | In Stock |
|
| 25g | RMB364.80 | In Stock |
|
| 100g | RMB1316.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 76-78 °C (lit.) |
| Boiling point: | 167 °C/11 mmHg (lit.) |
| Density | 1.1031 (rough estimate) |
| refractive index | 1.5589 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | ethanol: soluble50mg/mL, clear, yellow-green |
| pka | 15.00±0.46(Predicted) |
| form | Solid |
| color | White to off-white |
| Water Solubility | Insoluble in water. |
| InChI | InChI=1S/C8H9NO/c1-9-8(10)7-5-3-2-4-6-7/h2-6H,1H3,(H,9,10) |
| InChIKey | NCCHARWOCKOHIH-UHFFFAOYSA-N |
| SMILES | C(NC)(=O)C1=CC=CC=C1 |
| CAS DataBase Reference | 613-93-4(CAS DataBase Reference) |
| EPA Substance Registry System | N-Methylbenzamide (613-93-4) |
Description and Uses
N-Methylbenzamide is an important pesticide intermediate. It acts as a potent PDE10A (phosphodiesterase with a remarkable localization as the protein is abundant only in brain tissue) inhibitor.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-22 |
| Safety Statements | 24/25 |
| WGK Germany | 1 |
| RTECS | CV5570000 |
| TSCA | Yes |
| HS Code | 29242990 |





![Xylylazo Violet I [Spectrophotometric reagent for Mg]](https://img.chemicalbook.com/CAS/GIF/14936-97-1.gif)
