S9131314
thrombinsubstrate , 75241-23-5
CAS NO.：75241-23-5
Empirical Formula: C20H31ClN8O5
Molecular Weight: 498.97
MDL number: MFCD00058168
| Pack Size | Price | Stock | Quantity |
| 10mg | RMB4154.78 | In Stock |
|
| 25mg | RMB8188.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| storage temp. | -20°C |
| solubility | water: 25 mg/mL, clear, colorless to light yellow |
| form | powder |
| Water Solubility | water: 25mg/mL, clear, colorless to light yellow |
| InChIKey | KMSNYOSWLIQVAN-UHFFFAOYSA-N |
| SMILES | Cl.CNCC(=O)N1CCCC1C(=O)NC(CCCNC(N)=N)C(=O)Nc2ccc(cc2)N(=O)=O |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37 |
| WGK Germany | 1 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
