S9158414
≥98%(HPLC) , 160492-56-8
Synonym(s):
(R)-N-{{3-[1-Benzoyl-3-(3,4-dichlorophenyl)piperidin-3-yl]prop-1-yl}-4-phenylpiperidin-4-yl}-N-methylacetamine;SR142801;SR-142801
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB2346.01 | In Stock |
|
| 25mg | RMB8224.03 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 727.9±60.0 °C(Predicted) |
| Density | 1.25 |
| storage temp. | -20°C |
| solubility | DMSO: soluble15mg/mL, clear |
| pka | 8.33±0.10(Predicted) |
| form | powder |
| color | white to beige |
| optical activity | [α]/D +18 to +24°, c = 1 in methanol |
| InChIKey | DZOJBGLFWINFBF-UMSFTDKQSA-N |
| SMILES | Clc1c(ccc(c1)[C@@]4(CN(CCC4)C(=O)c5ccccc5)CCCN2CCC(CC2)(N(C)C(=O)C)c3ccccc3)Cl |
Description and Uses
Osanetant (SR142801) is a selective NK3 receptor antagonist. Osanetant produces anxiolytic- and antidepressant-like effects and is researched for schizophrenia[1].
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H319 |
| Precautionary statements | P264-P270-P280-P301+P312-P305+P351+P338-P337+P313 |
| Hazard Codes | Xn |
| Risk Statements | 22-36 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |
