S9164814
≥98%(HPLC) , 167354-41-8
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB1819.49 | In Stock |
|
| 25mg | RMB6523.61 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 690.5±55.0 °C(Predicted) |
| Density | 1.36 |
| storage temp. | -20°C |
| solubility | H2O: soluble4mg/mL, clear (warmed) |
| pka | 13.94±0.20(Predicted) |
| form | powder |
| color | white to beige |
| Water Solubility | H2O: 4mg/mL, clear (warmed) |
| InChIKey | VQJFFWJUYDGTQZ-FCNWNIDBSA-N |
| SMILES | O[C@@H](COC1=C(C=CC=N2)C2=CC=C1)CN(CC3)CCN3[C@@H]4C5=C(C=CC=C5)[C@@H]6[C@@H](C6(F)F)C7=C4C=CC=C7.Cl |
Description and Uses
Treatment of multidrug resistance (modulator of Pgp resistance).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






