S9211114
≥98%(HPLC),powder , 36622-28-3
CAS NO.：36622-28-3
Empirical Formula: C27H38N2O4
Molecular Weight: 454.6
MDL number: MFCD00869809
EINECS: 253-132-8
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB3471.57 | In Stock |
|
| 25mg | RMB13849.06 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 131-133 °C |
| solubility | H2O: >30 mg/mL |
| form | solid |
| color | white |
| optical activity | [α]22/D 6.1°, c = 0.1 in ethanol(lit.) |
| Water Solubility | H2O: >30mg/mL ethanol: soluble |
| InChIKey | ICKXRKHJKXMFLR-LPCSYZHESA-N |
| SMILES | O.Cl.COc1ccc(CCN(C)CCC[C@](C#N)(C(C)C)c2ccc(OC)c(OC)c2)cc1OC |
Description and Uses
Both isomers inhibit the p-glycoprotein efflux pump in multidrug resistant tumor cells.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P301+P310 |
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | T |
| Risk Statements | 25 |
| Safety Statements | 45 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |
