PRODUCT Properties
| Boiling point: | 146 °C (lit.) |
| Density | 1.404 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 173 °F |
| storage temp. | Refrigerator |
| solubility | Chloroform |
| pka | 13.09±0.10(Predicted) |
| form | Oil |
| color | Colourless |
| Stability: | Stable. Combustible. Incompatible with oxidizing agents. |
| InChI | InChI=1S/C2H4Cl2O/c3-2(4)1-5/h2,5H,1H2 |
| InChIKey | IDJOCJAIQSKSOP-UHFFFAOYSA-N |
| SMILES | C(O)C(Cl)Cl |
| CAS DataBase Reference | 598-38-9 |
| EPA Substance Registry System | 2,2-Dichloroethanol (598-38-9) |
Description and Uses
2,2-Dichloroethanol is a reagent in the preparation of tunable molecular catalysts via functionalizing methylene bridge of bis(N-heterocyclic carbene) ligands.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H351 |
| Precautionary statements | P202-P280-P301+P312-P302+P352+P312-P304+P340+P312-P308+P313 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-40 |
| Safety Statements | 7-23-36/37/39-45 |
| WGK Germany | 3 |
| RTECS | KK4100000 |
| TSCA | TSCA listed |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Carc. 2 |







