S037678
Bis(2,2,2-trichloroethyl) phosphorochloridate , 98% , 17672-53-6
CAS NO.:17672-53-6
Empirical Formula: C4 H4 Cl7 O3 P
Molecular Weight: 379.22
MDL number: MFCD00000809
EINECS: 241-650-7
| Pack Size | Price | Stock | Quantity |
| 10g | RMB950.33 | In Stock |
|
| 50g | RMB5083.92 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 45-47 °C (lit.) |
| Boiling point: | 351.0±42.0 °C(Predicted) |
| Density | 1.795±0.06 g/cm3(Predicted) |
| Flash point: | >230 °F |
| storage temp. | −20°C |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | solid |
| Appearance | White to off-white Solid |
| BRN | 1820707 |
| InChI | 1S/C4H4Cl7O3P/c5-3(6,7)1-13-15(11,12)14-2-4(8,9)10/h1-2H2 |
| InChIKey | ZHHCWQGVXYGWCW-UHFFFAOYSA-N |
| SMILES | ClC(Cl)(Cl)COP(Cl)(=O)OCC(Cl)(Cl)Cl |
Description and Uses
Bis(2,2,2-trichloroethyl) phosphorochloridate was used in the preparation of epimeric 6-deoxyhexofuranosyl nucleoside 5′ -phosphate.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-27-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| F | 10-21 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29209085 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |





