S955279
cis-8,11,14-Eicosatrienoic acid methyl ester , ≥99% , 21061-10-9
Synonym(s):
Dihomo-γ-linolenic acid methyl ester;Dihomo-γ-linolenic acid methyl ester solution;Fame 20:3n-6;Methyl DGLA
| Pack Size | Price | Stock | Quantity |
| 50mg | RMB2373.42 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 195-197℃ (0.6-1 Torr) |
| Density | 0.891±0.06 g/cm3(Predicted) |
| refractive index | 1.4712 (589.3 nm 20℃) |
| Flash point: | 14℃ |
| storage temp. | -20°C |
| solubility | 0.15 M Tris-HCl pH 8.5: 1 mg/ml; DMF: 100 mg/ml; DMSO: 100 mg/ml; Ethanol: 100 mg/ml; PBS (pH 7.2): .15 mg/ml |
| form | Liquid |
| color | Colorless to light yellow |
| biological source | synthetic |
| InChI | 1S/C21H36O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21(22)23-2/h7-8,10-11,13-14H,3-6,9,12,15-20H2,1-2H3/b8-7-,11-10-,14-13- |
| InChIKey | QHATYOWJCAQINT-JPFHKJGASA-N |
| SMILES | CCCCC\C=C/C\C=C/C\C=C/CCCCCCC(=O)OC |
Description and Uses
cis-8,11,14-Eicosatrienoic Acid Methyl Ester is the methyl ester derivative of cis-8,11,14-Eicosatrienoic Acid (E477930); a fatty acid with selective tumoricidal activity.
Safety
| Symbol(GHS) |   GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H225-H319 |
| Precautionary statements | P210-P280-P305+P351+P338-P337+P313-P403+P235 |
| PPE | Eyeshields, Gloves |
| RIDADR | UN1170 - class 3 - PG 2 - Ethanol, solution |
| WGK Germany | 3 |
| F | 10-23 |
| Storage Class | 10 - Combustible liquids |
