PRODUCT Properties
| Melting point: | 96°C |
| Boiling point: | 93℃ |
| Density | 1.5132 (rough estimate) |
| vapor pressure | 2 x 10-5 Pa (20 °C) |
| refractive index | 1.6000 (estimate) |
| storage temp. | -20°C |
| solubility | soluble in DMSO, Methanol |
| Water Solubility | 0.9 mg l-1 (20 °C) |
| pka | -5.06±0.50(Predicted) |
| Colour Index | 45430 |
| BRN | 2949607 |
| Major Application | agriculture environmental |
| InChI | 1S/C10H13Cl2FN2O2S2/c1-8-4-6-9(7-5-8)15(18-10(11,12)13)19(16,17)14(2)3/h4-7H,1-3H3 |
| InChIKey | HYVWIQDYBVKITD-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)N(SC(F)(Cl)Cl)c1ccc(C)cc1 |
| LogP | 3.900 |
| EPA Substance Registry System | Tolylfluanid (731-27-1) |
Description and Uses
Tolylfluanid is used to control a wide range of fungal diseases on apples, grapes, strawberries and other fruit and storage diseases on many crops.
Safety
| Symbol(GHS) |    GHS06,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H315-H317-H319-H330-H335-H372-H400 |
| Precautionary statements | P273-P280-P302+P352-P304+P340+P310-P305+P351+P338-P314 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | T,N,T+ |
| Risk Statements | 23-36/37/38-43-48/20-50/53-50-48/23-26 |
| Safety Statements | 24-26-37-38-45-60-61-63-36/37/39-28 |
| RIDADR | 2588 |
| WGK Germany | 3 |
| RTECS | WO6560000 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Inhalation Aquatic Acute 1 Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 STOT RE 1 STOT SE 3 |
| Hazardous Substances Data | 731-27-1(Hazardous Substances Data) |
