PRODUCT Properties
| Melting point: | 73-77 °C (lit.) |
| Boiling point: | 112°C 25mm |
| Density | 2.2482 (estimate) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| InChI | InChI=1S/C8F16I2/c9-1(10,3(13,14)5(17,18)7(21,22)25)2(11,12)4(15,16)6(19,20)8(23,24)26 |
| InChIKey | SRDQTCUHAMDAMG-UHFFFAOYSA-N |
| SMILES | C(F)(F)(I)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)I |
| CAS DataBase Reference | 335-70-6(CAS DataBase Reference) |
| EPA Substance Registry System | 1,8-Diiodoperfluorooctane (335-70-6) |
Description and Uses
1,8-Diiodoperfluorooctane (CAS# 335-70-6) is a perfluoroalkane used in the synthesis of semifluorinated polymers, and other perflourinated species.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280-P271 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2903780090 |
