S970377
trans-2-Phenylcyclopropyl isocyanate , 90%,remainderpredominantlycis , 63009-74-5
| Pack Size | Price | Stock | Quantity |
| 5g | RMB2149.52 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 75-76 °C0.5 mm Hg(lit.) |
| Density | 1.074 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 225 °F |
| form | liquid |
| InChI | 1S/C10H9NO/c12-7-11-10-6-9(10)8-4-2-1-3-5-8/h1-5,9-10H,6H2/t9-,10+/m0/s1 |
| InChIKey | DYUXVJAFBUZREW-VHSXEESVSA-N |
| SMILES | O=C=N[C@@H]1C[C@H]1c2ccccc2 |
Description and Uses
trans-2-Phenylcyclopropyl isocyanate was used as isocyante monomer during general solid-phase synthesis for identification of peroxisome proliferator-activated receptor ligands.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H302+H312+H332-H315-H317-H319-H334-H335 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352+P312-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 23-26-28-37/39 |
| RIDADR | UN 2206 6.1/PG 3 |
| WGK Germany | 3 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Resp. Sens. 1 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |







