PRODUCT Properties
| Melting point: | 108-110° |
| Boiling point: | 312.25°C (rough estimate) |
| Density | 1.1914 (rough estimate) |
| refractive index | 1.5557 (estimate) |
| storage temp. | APPROX 20°C |
| solubility | Soluble in most organic solvents (Worthing and Hance, 1991) |
| pka | 3.47±0.10(Predicted) |
| color | Bright yellow crystals |
| Water Solubility | 18 ppm at 25 °C (Gunther et al., 1968) |
| Merck | 13,7526 |
| BRN | 2051258 |
| Henry's Law Constant | 1.1×106 mol/(m3Pa) at 25℃, HSDB (2015) |
| Exposure limits | ACGIH:TLV-TWA 0.1 mg/m3 OSHA:PEL-TWA 0.1 mg/m3 NIOSH:REL-TWA 0.1 mg/m3 |
| Major Application | agriculture environmental |
| InChI | 1S/C14H14O3/c1-14(2,3)13(17)10-11(15)8-6-4-5-7-9(8)12(10)16/h4-7,10H,1-3H3 |
| InChIKey | RZKYEQDPDZUERB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)C1C(=O)c2ccccc2C1=O |
| EPA Substance Registry System | Pindone (83-26-1) |
Description and Uses
Insecticide; rodenticide
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS06,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H301-H372-H410 |
| Precautionary statements | P264-P270-P260-P273-P301+P310-P330-P314-P391-P405-P501 |
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | T,N |
| Risk Statements | 25-48/25-50/53 |
| Safety Statements | 37-45-60-61 |
| RIDADR | 3027 |
| OEB | D |
| OEL | TWA: 0.1 mg/m3 |
| WGK Germany | 3 |
| RTECS | NK6300000 |
| TSCA | TSCA listed |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29143990 |
| Storage Class | 6.1C - Combustible, acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Aquatic Acute 1 Aquatic Chronic 1 STOT RE 1 Oral |
| Hazardous Substances Data | 83-26-1(Hazardous Substances Data) |
| Toxicity | LD50 orally in male rats: 280 mg/kg (Gaines) |
| IDLA | 100 mg/m3 |







