S983277
3-Nitrobenzamidine hydrochloride , 95% , 56406-50-9
CAS NO.：56406-50-9
Empirical Formula: C7H8ClN3O2
Molecular Weight: 201.61
MDL number: MFCD00012844
EINECS: 260-159-9
| Pack Size | Price | Stock | Quantity |
| 5g | RMB793.31 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 245-248 °C(lit.) |
| InChI | 1S/C7H7N3O2.ClH/c8-7(9)5-2-1-3-6(4-5)10(11)12;/h1-4H,(H3,8,9);1H |
| InChIKey | DKNQVJWYIUJWNC-UHFFFAOYSA-N |
| SMILES | Cl.NC(=N)c1cccc(c1)[N+]([O-])=O |
Description and Uses
3-Nitrobenzamidine hydrochloride was used as reagent during the synthesis of (Z)-3-benzoylamino-4-dimethylamino-2-oxo-3-butene.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | CV6295000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
