S9937748
testsetforcalibratingtheabsorbanceofspectrophotometers
CAS NO.:
Empirical Formula: C18H15ClD4N4
Molecular Weight: 330.85
MDL number: MFCD01073510
EINECS: 803-305-4
| Pack Size | Price | Stock | Quantity |
| 1set | RMB3941.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Flash point: | 9℃ |
| storage temp. | -20°C |
| solubility | DMF: 10 mg/ml,DMSO: 10 mg/ml,DMSO:PBS(pH7.2) (1:1): 0.5 mg/ml,Ethanol: 5 mg/ml |
| form | Solid |
| color | Light Yellow to Yellow |
| Major Application | clinical testing |
| InChI | 1S/C18H19ClN4/c1-22-8-10-23(11-9-22)18-14-4-2-3-5-15(14)20-16-7-6-13(19)12-17(16)21-18/h2-7,12,20H,8-11H2,1H3/i10D2,11D2 |
| InChIKey | QZUDBNBUXVUHMW-MKQHWYKPSA-N |
| SMILES | CN(CC1([2H])[2H])CC([2H])([2H])N1C2=NC(C=C(Cl)C=C3)=C3NC4=CC=CC=C24 |
| CAS Number Unlabeled | 5786-21-0 |
Description and Uses
Clozapine-d4 can act as modulators of dopamine receptors, serotonin receptors, adrenergic receptors, acetylcholine receptors, and/or histamine receptors.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS02,GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H225-H301+H311+H331-H370 |
| Precautionary statements | P210-P260-P280-P301+P310-P311 |
| target organs | Eyes |
| Hazard Codes | F,T |
| Risk Statements | 11-23/24/25-39/23/24/25 |
| Safety Statements | 7-16-36/37-45 |
| RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution |
| WGK Germany | 1 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Flam. Liq. 2 STOT SE 1 |





