T0010131
Triethanolamine Borate , >95.0%(T) , 283-56-7
Synonym(s):
2,2′,2′′-Nitrilotriethyl borate;Boratrane
CAS NO.:283-56-7
Empirical Formula: C6H12BNO3
Molecular Weight: 156.98
MDL number: MFCD00003272
EINECS: 206-003-5
| Pack Size | Price | Stock | Quantity |
| 25g | RMB308.00 | In Stock |
|
| 100g | RMB896.00 | In Stock |
|
| 500g | RMB2872.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 235-237 °C(lit.) |
| Boiling point: | 149.6±39.0 °C(Predicted) |
| Density | 1.13±0.1 g/cm3(Predicted) |
| storage temp. | Room Temperature, under inert atmosphere |
| solubility | slightly soluble in acetone, benzene |
| pka | 6.40±0.20(Predicted) |
| form | Powder |
| color | white |
| Odor | odorless |
| BRN | 774536 |
| InChI | InChI=1S/C6H12BNO3/c1-4-9-7-10-5-2-8(1)3-6-11-7/h1-6H2 |
| InChIKey | NKPKVNRBHXOADG-UHFFFAOYSA-N |
| SMILES | B12OCCN(CCO1)CCO2 |
| CAS DataBase Reference | 283-56-7 |
Description and Uses
Triethanolamine Borate is an intermediate in the synthesis of Silatrane (S433000) which can be used as a reversible cholinesterase inhibitor. Silatrane and its derivatives can also be used as antitumor agents.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37 |
| WGK Germany | 3 |
| RTECS | YJ8968050 |
| F | 10-21 |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Toxicity | LD ivn-mus: >100 mg/kg EJMCA5 13,207,78 |





