PRODUCT Properties
| Boiling point: | 169 °C |
| Density | 1.66 |
| refractive index | 1.442-1.444 |
| form | clear liquid |
| pka | 2.83±0.50(Predicted) |
| color | Colorless to Light yellow to Light orange |
| Specific Gravity | 1.66 |
| InChI | 1S/C7HF7S/c8-2-1(7(12,13)14)3(9)5(11)6(15)4(2)10/h15H |
| InChIKey | BXMOMKVOHOSVJH-UHFFFAOYSA-N |
| SMILES | Fc1c(F)c(c(F)c(F)c1S)C(F)(F)F |
| CAS DataBase Reference | 651-84-3(CAS DataBase Reference) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H227-H315-H319 |
| Precautionary statements | P210-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P403+P235-P501 |
| target organs | Respiratory system |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26 |
| WGK Germany | WGK 3 |
| HazardClass | IRRITANT |
| HS Code | 29309099 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
