T0033731
3,3,5,5-Tetramethyl-1-pyrroline N-Oxide , >98.0%(GC) , 10135-38-3
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB484.00 | In Stock |
|
| 1g | RMB2324.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 58-61 °C(lit.) |
| Boiling point: | 73 °C1 mm Hg(lit.) |
| Density | 0.9938 (rough estimate) |
| refractive index | 1.4610 (estimate) |
| storage temp. | -20°C |
| solubility | DMSO: Soluble: = 10 mg/ml Ethanol: Soluble: = 10 mg/mlPBS (pH 7.2): Soluble: = 10 mg/ml |
| pka | 2.50±0.60(Predicted) |
| form | powder to crystal |
| color | White to Orange to Green |
| InChI | 1S/C8H15NO/c1-7(2)5-8(3,4)9(10)6-7/h6H,5H2,1-4H3 |
| InChIKey | GUQARRULARNYQZ-UHFFFAOYSA-N |
| SMILES | CC1(C)CC(C)(C)[N+]([O-])=C1 |
| CAS DataBase Reference | 10135-38-3 |
Description and Uses
TMPO is a pyrroline-based N-oxyl spin trap. TMPO is described for use as a cell-permeable spin trap probe for ESR studies of biological systems.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29339980 |
| Storage Class | 11 - Combustible Solids |






