PRODUCT Properties
Melting point: | 116°C (estimate) |
Boiling point: | 214 °C(lit.) |
Density | 0.93 g/mL at 25 °C(lit.) |
refractive index | n |
Flash point: | 195 °F |
solubility | Chloroform, Methanol (Slightly) |
form | Liquid |
pka | 10.02±0.10(Predicted) |
Specific Gravity | 0.930 |
color | Clear colorless to light yellow |
InChI | InChI=1S/C9H13N/c1-8-2-4-9(5-3-8)6-7-10/h2-5H,6-7,10H2,1H3 |
InChIKey | VKJXAQYPOTYDLO-UHFFFAOYSA-N |
SMILES | C1(CCN)=CC=C(C)C=C1 |
CAS DataBase Reference | 3261-62-9(CAS DataBase Reference) |
NIST Chemistry Reference | 2-(p-Tolyl)ethylamine(3261-62-9) |
Description and Uses
2-(p-Tolyl)ethylamine was used to prepare secondary amides by amidation of sophorolipid ethyl ester.
Safety
Symbol(GHS) | ![]() GHS07 |
Signal word | Warning |
Hazard statements | H315-H319-H335 |
Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
Hazard Codes | Xi,C |
Risk Statements | 36/37/38 |
Safety Statements | 26-36/37/39-37/39 |
RIDADR | UN 2922 8/6.1/PG II |
WGK Germany | 3 |
RTECS | DA0306700 |
HazardClass | CORROSIVE |
PackingGroup | II |
HS Code | 29215900 |