PRODUCT Properties
| Melting point: | 116°C (estimate) |
| Boiling point: | 214 °C(lit.) |
| Density | 0.93 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 195 °F |
| solubility | Chloroform, Methanol (Slightly) |
| form | Liquid |
| pka | 10.02±0.10(Predicted) |
| Specific Gravity | 0.930 |
| color | Clear colorless to light yellow |
| InChI | InChI=1S/C9H13N/c1-8-2-4-9(5-3-8)6-7-10/h2-5H,6-7,10H2,1H3 |
| InChIKey | VKJXAQYPOTYDLO-UHFFFAOYSA-N |
| SMILES | C1(CCN)=CC=C(C)C=C1 |
| CAS DataBase Reference | 3261-62-9(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-(p-Tolyl)ethylamine(3261-62-9) |
Description and Uses
2-(p-Tolyl)ethylamine was used to prepare secondary amides by amidation of sophorolipid ethyl ester.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi,C |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39-37/39 |
| RIDADR | UN 2922 8/6.1/PG II |
| WGK Germany | 3 |
| RTECS | DA0306700 |
| HazardClass | CORROSIVE |
| PackingGroup | II |
| HS Code | 29215900 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






