T3372931
Aclonifen , >97.0%(HPLC) , 74070-46-5
Synonym(s):
2-Chloro-6-nitro-3-phenoxyaniline
CAS NO.：74070-46-5
Empirical Formula: C12H9ClN2O3
Molecular Weight: 264.66
MDL number: MFCD00143542
EINECS: 277-704-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB396.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 81.5 °C |
| Boiling point: | 361.5±42.0 °C(Predicted) |
| Density | 1.4257 (rough estimate) |
| refractive index | 1.5800 (estimate) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | -3.15±0.25(Predicted) |
| color | Light yellow to Yellow to Orange |
| BRN | 8321574 |
| Major Application | agriculture environmental |
| InChI | InChI=1S/C12H9ClN2O3/c13-11-10(18-8-4-2-1-3-5-8)7-6-9(12(11)14)15(16)17/h1-7H,14H2 |
| InChIKey | DDBMQDADIHOWIC-UHFFFAOYSA-N |
| SMILES | C1(N)=C([N+]([O-])=O)C=CC(OC2=CC=CC=C2)=C1Cl |
| LogP | 4.040 |
| EPA Substance Registry System | Aclonifen (74070-46-5) |
Description and Uses
Aclonifen is used as a pesticide and herbicide.
Safety
| Symbol(GHS) |    GHS07,GHS08,GHS09 |
| Signal word | Warning |
| Hazard statements | H317-H351-H410 |
| Precautionary statements | P201-P202-P273-P280-P302+P352-P308+P313 |
| PPE | Eyeshields, Gloves |
| Hazard Codes | N |
| Risk Statements | 50/53 |
| Safety Statements | 60-61 |
| RIDADR | UN3077 9/PG 3 |
| WGK Germany | 2 |
| RTECS | CX9858650 |
| HS Code | 29214200 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Carc. 2 Skin Sens. 1A |
