T3395931
1-(tert-Butyldimethylsilyloxy)-1-methoxyethene , >97.0%(GC) , 77086-38-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB236.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 74-76 °C |
| Boiling point: | 62 °C/9 mmHg (lit.) |
| Density | 0.863 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 125 °F |
| storage temp. | Room Temperature (Recommended in a cool and dark place, <15°C) |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Specific Gravity | 0.87 |
| InChI | InChI=1S/C9H20O2Si/c1-8(10-5)11-12(6,7)9(2,3)4/h1H2,2-7H3 |
| InChIKey | UVCCWXJGWMGZAB-UHFFFAOYSA-N |
| SMILES | [Si](C(C)(C)C)(OC(OC)=C)(C)C |
Description and Uses
1-(tert-Butyldimethylsilyloxy)-1-methoxyethene can be used for synthesis of β-hydroxy esters, indolyl-β3, 3-aminoacid esters and nitroso acetals etc.
Safety
| Symbol(GHS) | ![]() GHS02 |
| Signal word | Warning |
| Hazard statements | H315-H319-H226 |
| Precautionary statements | P501-P240-P210-P233-P243-P241-P242-P264-P280-P370+P378-P337+P313-P305+P351+P338-P362+P364-P303+P361+P353-P332+P313-P403+P235 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Risk Statements | 10 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| HazardClass | 3 |
| HS Code | 2931900090 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Flam. Liq. 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |



