T3398631
5-[4'-(Bromomethyl)-1,1'-biphenyl-2-yl]-2-triphenylmethyl-2H-tetrazole , >98.0%(T)(HPLC) , 133051-88-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB412.00 | In Stock |
|
| 5g | RMB1264.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 135-137 °C(Solv: ethyl ether (60-29-7)) |
| Boiling point: | 718.4±70.0 °C(Predicted) |
| Density | 1.28±0.1 g/cm3(Predicted) |
| storage temp. | -20°C Freezer, Under inert atmosphere |
| solubility | Chloroform (Sparingly), Methanol (Slightly, Heated) |
| form | Solid |
| pka | -0.09±0.12(Predicted) |
| color | White to Pale Yellow |
| Stability: | Moisture Sensitive |
| InChI | InChI=1S/C33H25BrN4/c34-24-25-20-22-26(23-21-25)30-18-10-11-19-31(30)32-35-37-38(36-32)33(27-12-4-1-5-13-27,28-14-6-2-7-15-28)29-16-8-3-9-17-29/h1-23H,24H2 |
| InChIKey | WROIFZUSIQAQBZ-UHFFFAOYSA-N |
| SMILES | N1=C(C2=CC=CC=C2C2=CC=C(CBr)C=C2)N=NN1C(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 |
Description and Uses
An intermediate in the synthesis of Losartan and Valsartan.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H315 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |
| HS Code | 2933.99.8290 |

![5-[4'-(Bromomethyl)-1,1'-biphenyl-2-yl]-2-triphenylmethyl-2H-tetrazole](https://img.chemicalbook.com/CAS/GIF/133051-88-4.gif)





