T3502031
4-Pentylphenyl 4-Methoxybenzoate , >98.0%(GC) , 38444-13-2
Synonym(s):
4-n-Pentylphenyl p-anisate;4-Amylphenyl 4′-methoyxbenzoate;Nematal 105
CAS NO.:38444-13-2
Empirical Formula: C19H22O3
Molecular Weight: 298.38
MDL number: MFCD08276868
EINECS: 253-932-7
| Pack Size | Price | Stock | Quantity |
| 5g | RMB1000.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 28-42 °C |
| Boiling point: | 429.7±38.0 °C(Predicted) |
| Density | 1.068±0.06 g/cm3(Predicted) |
| Flash point: | 110 °C |
| storage temp. | 2-8°C |
| solubility | soluble in Methanol |
| form | powder to crystal |
| color | White to Light yellow |
| Cosmetics Ingredients Functions | SKIN CONDITIONING |
| InChI | 1S/C19H22O3/c1-3-4-5-6-15-7-11-18(12-8-15)22-19(20)16-9-13-17(21-2)14-10-16/h7-14H,3-6H2,1-2H3 |
| InChIKey | UISXVYOLBGBYCV-UHFFFAOYSA-N |
| SMILES | CCCCCc1ccc(OC(=O)c2ccc(OC)cc2)cc1 |
| EPA Substance Registry System | Benzoic acid, 4-methoxy-, 4-pentylphenyl ester (38444-13-2) |
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H315-H317-H319-H410 |
| Precautionary statements | P273-P280-P305+P351+P338-P501 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xi,N |
| Risk Statements | 36/38-43-50/53 |
| Safety Statements | 26-37/39-60-61 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 2918.99.4700 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Chronic 4 Skin Sens. 1 |








![4'-Cyano-[1,1'-biphenyl]-4-yl4-pentylbenzoate](https://img.chemicalbook.com/CAS/GIF/59443-80-0.gif)