BD8837031
4-n-Pentylphenyl-4-methylbenzoate , 98% , 50649-59-7
Synonym(s):
p-Amylphenyl p-toluate;p-Pentylphenyl p-methylbenzoate
CAS NO.：50649-59-7
Empirical Formula: C19H22O2
Molecular Weight: 282.38
MDL number: MFCD01076322
EINECS: 256-683-2
| Pack Size | Price | Stock | Quantity |
| 1g | RMB27.20 | In Stock |
|
| 5g | RMB46.40 | In Stock |
|
| 25g | RMB166.40 | In Stock |
|
| 100g | RMB597.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 34-38 °C |
| Boiling point: | 409.3±34.0 °C(Predicted) |
| Density | 1.040±0.06 g/cm3(Predicted) |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| form | liquid crystal |
| Appearance | White to off-white Solid |
| InChI | 1S/C19H22O2/c1-3-4-5-6-16-9-13-18(14-10-16)21-19(20)17-11-7-15(2)8-12-17/h7-14H,3-6H2,1-2H3 |
| InChIKey | OFNFLSYTTLXGBM-UHFFFAOYSA-N |
| SMILES | CCCCCc1ccc(OC(=O)c2ccc(C)cc2)cc1 |
Description and Uses
Intermediates of Liquid Crystals
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves |
| Hazard Codes | N |
| Risk Statements | 50/53 |
| Safety Statements | 60-61 |
| RIDADR | UN 3082 9/PG 3 |
| WGK Germany | 3 |
| Storage Class | 13 - Non Combustible Solids |
| Hazard Classifications | Aquatic Chronic 4 |
