PRODUCT Properties
| Density | 1.27[at 20℃] |
| vapor pressure | 0Pa at 25℃ |
| storage temp. | 2-8°C, sealed storage, away from moisture |
| form | powder to crystal |
| color | Orange to Brown to Dark purple |
| Water Solubility | 18.9g/L at 20℃ |
| λmax | 525nm(H2O)(lit.) |
| InChIKey | WDTZNHRKHNKDOU-UHFFFAOYSA-M |
| SMILES | C(C1C=CC=CC=1C1C2=CC(C)=C(NCC)C=C2[O+]=C2C=C(NCC)C(C)=CC=12)(=O)OC.[Cl-] |
| LogP | 1.7 at 20℃ |
| CAS DataBase Reference | 3068-39-1(CAS DataBase Reference) |
| EPA Substance Registry System | Xanthylium, 3,6-bis(ethylamino)-9-[2-(methoxycarbonyl)phenyl]-2,7-dimethyl-, chloride (3068-39-1) |
Description and Uses
Rhodamine 590 Chloride is an extensively employed fluorescent dye within biomedical research. It possesses multifaceted applications in cell imaging and tracking, enabling the examination of intricate cellular phenomena and their interrelations. Its wide utilization prevails in the identification and visual representation of specific antibodies, proteins, and nucleic acids. Driven by its unparalleled sensitivity and photostability attributes, Rhodamine 590 Chloride emerges as an indispensable instrument, facilitating profound insights into the intricate realm of molecular biology and disease mechanisms.
C.I.BASIC RED 1:1 is a useful research chemical used as a fluorescent dye.
Safety
| Symbol(GHS) | ![]() ![]() ![]() ![]() GHS05,GHS06,GHS07,GHS09 |
| Signal word | Danger |
| Hazard statements | H302-H317-H318-H330-H410 |
| Precautionary statements | P260-P264-P270-P271-P272-P273-P280-P284-P301+P312+P330-P302+P352+P333+P313+P363-P304+P340+P310-P305+P351+P338+P310-P391-P403+P233-P405-P501 |
| RIDADR | UN 2811 6.1/PG II |
| HS Code | 2933.49.7000 |
| HazardClass | 6.1 |
| PackingGroup | II |









