PRODUCT Properties
| Boiling point: | 130 °C |
| Density | 0,95 g/cm3 |
| refractive index | 1.4310-1.4340 |
| storage temp. | 0-10°C |
| solubility | soluble in Methanol |
| form | clear liquid |
| color | Colorless to Light yellow |
| Odor | pungent ethereal |
| InChI | InChI=1S/C6H10O2/c1-4-5(2)6(7)8-3/h4H,1-3H3/b5-4- |
| InChIKey | YYJWBYNQJLBIGS-PLNGDYQASA-N |
| SMILES | C(OC)(=O)/C(/C)=C\C |
| LogP | 1.715 (est) |
Description and Uses
Angelic Acid Methyl Ester is a reactant in the synthesis of natural (-)-Evoninic acid.
Safety
| Symbol(GHS) |  GHS02 |
| Signal word | Warning |
| Hazard statements | H226 |
| Precautionary statements | P210-P233-P240-P241+P242+P243-P280-P303+P361+P353-P370+P378-P403+P235-P501 |
| Risk Statements | 10 |
| Safety Statements | 16 |
| RIDADR | 3272 |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 2916199590 |
