T7600530
Allyltriphenyltin , >95.0%(W) , 76-63-1
Synonym(s):
2-Propenyl-triphenylstannane;Allyltriphenyltin
CAS NO.:76-63-1
Empirical Formula: C21H20Sn
Molecular Weight: 391.09
MDL number: MFCD00048162
EINECS: 200-975-4
| Pack Size | Price | Stock | Quantity |
| 5g | RMB384.00 | In Stock |
|
| 25g | RMB1160.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 71-74 °C(lit.) |
| Boiling point: | 421.4±38.0 °C(Predicted) |
| Density | 1,07 g/cm3 |
| Flash point: | >100 |
| Water Solubility | Insoluble in water |
| form | solid |
| color | White to Almost white |
| Hydrolytic Sensitivity | 1: no significant reaction with aqueous systems |
| BRN | 3612762 |
| InChI | 1S/3C6H5.C3H5.Sn/c3*1-2-4-6-5-3-1;1-3-2;/h3*1-5H;3H,1-2H2; |
| InChIKey | NDUYAGLANMHJHF-UHFFFAOYSA-N |
| SMILES | C=CC[Sn](c1ccccc1)(c2ccccc2)c3ccccc3 |
| CAS DataBase Reference | 76-63-1(CAS DataBase Reference) |
Description and Uses
Allyltriphenyltin is an insect chemosterilants.
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H301+H311+H331-H410 |
| Precautionary statements | P273-P280-P301+P310+P330-P302+P352+P312-P304+P340+P311 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | T,N |
| Risk Statements | 23/24/25-50/53 |
| Safety Statements | 26-27-28-45-60-61 |
| RIDADR | UN 3146 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | WH6705000 |
| TSCA | No |
| HS Code | 2931.90.6000 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Aquatic Acute 1 Aquatic Chronic 1 |







