T7631330
6-Amino-2,4-dichloro-3-ethylphenol Hydrochloride , >98.0%(T)(HPLC) , 101819-99-2
| Pack Size | Price | Stock | Quantity |
| 5g | RMB112.00 | In Stock |
|
| 25g | RMB336.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| storage temp. | RT, stored under nitrogen |
| solubility | Methanol[soluble in] |
| solubility | soluble in Methanol |
| form | powder to crystal |
| color | Light yellow to Brown to Dark green |
| InChI | InChI=1S/C8H9Cl2NO.ClH/c1-2-4-5(9)3-6(11)8(12)7(4)10;/h3,12H,2,11H2,1H3;1H |
| InChIKey | XZZITYVICUAZNB-UHFFFAOYSA-N |
| SMILES | C1(CC)C(Cl)=CC(N)=C(O)C=1Cl.Cl |
| CAS DataBase Reference | 101819-99-2(CAS DataBase Reference) |
| EPA Substance Registry System | Phenol, 6-amino-2,4-dichloro-3-ethyl-, hydrochloride (101819-99-2) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| HS Code | 2922.29.8190 |
